C16H13BrF2OS — CID 106266342
2-(3-bromo-2,6-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone (PubChem CID 106266342) has the molecular formula C16H13BrF2OS and a molecular weight of 371.25 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 106266342 |
| Molecular Formula | C16H13BrF2OS |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 369.98 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-ethylsulfanylphenyl)ethanone |
| SMILES | CCSc1ccc(C(=O)Cc2c(F)ccc(Br)c2F)cc1 |
| InChI | InChI=1S/C16H13BrF2OS/c1-2-21-11-5-3-10(4-6-11)15(20)9-12-14(18)8-7-13(17)16(12)19/h3-8H,2,9H2,1H3 |
| InChIKey | FIAMLFKMOXYOQP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|