C16H12BrF2NO — CID 106272807
2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dihydro-1H-isoindol-5-yl)ethanone (PubChem CID 106272807) has the molecular formula C16H12BrF2NO and a molecular weight of 352.18 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dihydro-1H-isoindol-5-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dihydro-1H-isoindol-5-yl)ethanone |
|---|---|
| PubChem CID | 106272807 |
| Molecular Formula | C16H12BrF2NO |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dihydro-1H-isoindol-5-yl)ethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)c1ccc2c(c1)CNC2 |
| InChI | InChI=1S/C16H12BrF2NO/c17-13-3-4-14(18)12(16(13)19)6-15(21)9-1-2-10-7-20-8-11(10)5-9/h1-5,20H,6-8H2 |
| InChIKey | PEANHKIITBAGGY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|