C14H8Cl2F2O — CID 63409918
1-(3,4-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone (PubChem CID 63409918) has the molecular formula C14H8Cl2F2O and a molecular weight of 301.12 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 63409918 |
| Molecular Formula | C14H8Cl2F2O |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 299.99 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-(3,5-difluorophenyl)ethanone |
| SMILES | O=C(Cc1cc(F)cc(F)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl2F2O/c15-12-2-1-9(6-13(12)16)14(19)5-8-3-10(17)7-11(18)4-8/h1-4,6-7H,5H2 |
| InChIKey | DOYORFXYUZURJX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |