C14H12F2N2O — CID 105412051
1-[2-(aminomethyl)-4-pyridinyl]-2-(3,5-difluorophenyl)ethanone (PubChem CID 105412051) has the molecular formula C14H12F2N2O and a molecular weight of 262.26 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-4-pyridinyl]-2-(3,5-difluorophenyl)ethanone.
| Compound Name | 1-[2-(aminomethyl)-4-pyridinyl]-2-(3,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 105412051 |
| Molecular Formula | C14H12F2N2O |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-[2-(aminomethyl)-4-pyridinyl]-2-(3,5-difluorophenyl)ethanone |
| SMILES | NCc1cc(C(=O)Cc2cc(F)cc(F)c2)ccn1 |
| InChI | InChI=1S/C14H12F2N2O/c15-11-3-9(4-12(16)7-11)5-14(19)10-1-2-18-13(6-10)8-17/h1-4,6-7H,5,8,17H2 |
| InChIKey | RFWQMQBNVCSBBW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |