C14H8Cl4O — CID 63409426
2-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)ethanone (PubChem CID 63409426) has the molecular formula C14H8Cl4O and a molecular weight of 334.03 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 63409426 |
| Molecular Formula | C14H8Cl4O |
| Molecular Weight | 334.03 g/mol |
| Exact Mass | 331.93 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-(3,4-dichlorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H8Cl4O/c15-10-3-1-8(12(17)7-10)6-14(19)9-2-4-11(16)13(18)5-9/h1-5,7H,6H2 |
| InChIKey | CZWJKKIVSUVFNR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.03 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |