C8H6Cl2OS — CID 58957134
1-(3,4-dichlorophenyl)-2-sulfanylethanone (PubChem CID 58957134) has the molecular formula C8H6Cl2OS and a molecular weight of 221.11 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-sulfanylethanone.
| Compound Name | 1-(3,4-dichlorophenyl)-2-sulfanylethanone |
|---|---|
| PubChem CID | 58957134 |
| Molecular Formula | C8H6Cl2OS |
| Molecular Weight | 221.11 g/mol |
| Exact Mass | 219.95 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-sulfanylethanone |
| SMILES | O=C(CS)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2OS/c9-6-2-1-5(3-7(6)10)8(11)4-12/h1-3,12H,4H2 |
| InChIKey | FCNMJPKDGXEHIA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.11 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|