C11H14Cl3NO — CID 10968004
[3-(3,4-dichlorophenyl)-3-oxopropyl]-dimethylazanium chloride (PubChem CID 10968004) has the molecular formula C11H14Cl3NO and a molecular weight of 282.60 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-3-oxopropyl]-dimethylazanium chloride.
| Compound Name | [3-(3,4-dichlorophenyl)-3-oxopropyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 10968004 |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-3-oxopropyl]-dimethylazanium chloride |
| SMILES | C[NH+](C)CCC(=O)c1ccc(Cl)c(Cl)c1.[Cl-] |
| InChI | InChI=1S/C11H13Cl2NO.ClH/c1-14(2)6-5-11(15)8-3-4-9(12)10(13)7-8;/h3-4,7H,5-6H2,1-2H3;1H |
| InChIKey | PRRKQCKNKRZOPV-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |