C13H10Cl2N2O — CID 81491660
2-(2-amino-4-pyridinyl)-1-(3,4-dichlorophenyl)ethanone (PubChem CID 81491660) has the molecular formula C13H10Cl2N2O and a molecular weight of 281.14 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-1-(3,4-dichlorophenyl)ethanone.
| Compound Name | 2-(2-amino-4-pyridinyl)-1-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 81491660 |
| Molecular Formula | C13H10Cl2N2O |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-1-(3,4-dichlorophenyl)ethanone |
| SMILES | Nc1cc(CC(=O)c2ccc(Cl)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C13H10Cl2N2O/c14-10-2-1-9(7-11(10)15)12(18)5-8-3-4-17-13(16)6-8/h1-4,6-7H,5H2,(H2,16,17) |
| InChIKey | GNOAXUNALXBWQC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |