C12H10Cl2N2 — CID 54402411
4-[(3,4-dichlorophenyl)methyl]pyridin-2-amine (PubChem CID 54402411) has the molecular formula C12H10Cl2N2 and a molecular weight of 253.13 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methyl]pyridin-2-amine.
| Compound Name | 4-[(3,4-dichlorophenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 54402411 |
| Molecular Formula | C12H10Cl2N2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methyl]pyridin-2-amine |
| SMILES | Nc1cc(Cc2ccc(Cl)c(Cl)c2)ccn1 |
| InChI | InChI=1S/C12H10Cl2N2/c13-10-2-1-8(6-11(10)14)5-9-3-4-16-12(15)7-9/h1-4,6-7H,5H2,(H2,15,16) |
| InChIKey | MOEROKYWZZMNCB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |