About ethane;4-ethylpyridin-2-amine
ethane;4-ethylpyridin-2-amine (PubChem CID 144736585) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is ethane;4-ethylpyridin-2-amine.
Molecular Properties
| Compound Name | ethane;4-ethylpyridin-2-amine |
| PubChem CID | 144736585 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | ethane;4-ethylpyridin-2-amine |
| SMILES | CC.CC.CCc1ccnc(N)c1 |
| InChI | InChI=1S/C7H10N2.2C2H6/c1-2-6-3-4-9-7(8)5-6;2*1-2/h3-5H,2H2,1H3,(H2,8,9);2*1-2H3 |
| InChIKey | MRMVCODXTBNIFU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-ethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethylpyridin-2-amine?
The IUPAC name of ethane;4-ethylpyridin-2-amine (CID 144736585) is ethane;4-ethylpyridin-2-amine.
What is the SMILES notation for ethane;4-ethylpyridin-2-amine?
The canonical SMILES for ethane;4-ethylpyridin-2-amine is CC.CC.CCc1ccnc(N)c1.
What is the InChIKey of ethane;4-ethylpyridin-2-amine?
The InChIKey is MRMVCODXTBNIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.2C2H6/c1-2-6-3-4-9-7(8)5-6;2*1-2/h3-5H,2H2,1H3,(H2,8,9);2*1-2H3.
What are the key properties of ethane;4-ethylpyridin-2-amine?
ethane;4-ethylpyridin-2-amine has a molecular weight of 182.31 g/mol, XLogP of 3.28, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethylpyridin-2-amine is sourced from PubChem (CID 144736585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).