About 4-(aminomethyl)pyridin-2-amine;methane
4-(aminomethyl)pyridin-2-amine;methane (PubChem CID 158878450) has the molecular formula C7H13N3
and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-(aminomethyl)pyridin-2-amine;methane.
Molecular Properties
| Compound Name | 4-(aminomethyl)pyridin-2-amine;methane |
| PubChem CID | 158878450 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | 4-(aminomethyl)pyridin-2-amine;methane |
| SMILES | C.NCc1ccnc(N)c1 |
| InChI | InChI=1S/C6H9N3.CH4/c7-4-5-1-2-9-6(8)3-5;/h1-3H,4,7H2,(H2,8,9);1H4 |
| InChIKey | JCSSJIBQXKKPGB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(aminomethyl)pyridin-2-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)pyridin-2-amine;methane?
The IUPAC name of 4-(aminomethyl)pyridin-2-amine;methane (CID 158878450) is 4-(aminomethyl)pyridin-2-amine;methane.
What is the SMILES notation for 4-(aminomethyl)pyridin-2-amine;methane?
The canonical SMILES for 4-(aminomethyl)pyridin-2-amine;methane is C.NCc1ccnc(N)c1.
What is the InChIKey of 4-(aminomethyl)pyridin-2-amine;methane?
The InChIKey is JCSSJIBQXKKPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3.CH4/c7-4-5-1-2-9-6(8)3-5;/h1-3H,4,7H2,(H2,8,9);1H4.
What are the key properties of 4-(aminomethyl)pyridin-2-amine;methane?
4-(aminomethyl)pyridin-2-amine;methane has a molecular weight of 139.20 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)pyridin-2-amine;methane is sourced from PubChem (CID 158878450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).