C8H10F2N2O — CID 112575631
3-(2-amino-4-pyridinyl)-1,1-difluoropropan-2-ol (PubChem CID 112575631) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is 3-(2-amino-4-pyridinyl)-1,1-difluoropropan-2-ol.
| Compound Name | 3-(2-amino-4-pyridinyl)-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 112575631 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3-(2-amino-4-pyridinyl)-1,1-difluoropropan-2-ol |
| SMILES | Nc1cc(CC(O)C(F)F)ccn1 |
| InChI | InChI=1S/C8H10F2N2O/c9-8(10)6(13)3-5-1-2-12-7(11)4-5/h1-2,4,6,8,13H,3H2,(H2,11,12) |
| InChIKey | FPADTNYAVPTIFJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |