C8H14N4 — CID 105201271
4-(2-hydrazinylpropyl)pyridin-2-amine (PubChem CID 105201271) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 4-(2-hydrazinylpropyl)pyridin-2-amine.
| Compound Name | 4-(2-hydrazinylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105201271 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 4-(2-hydrazinylpropyl)pyridin-2-amine |
| SMILES | CC(Cc1ccnc(N)c1)NN |
| InChI | InChI=1S/C8H14N4/c1-6(12-10)4-7-2-3-11-8(9)5-7/h2-3,5-6,12H,4,10H2,1H3,(H2,9,11) |
| InChIKey | PIQZCRUUCKUXPK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|