C13H14F2N4 — CID 105207856
4-[2-(3,5-difluorophenyl)-2-hydrazinylethyl]pyridin-2-amine (PubChem CID 105207856) has the molecular formula C13H14F2N4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenyl)-2-hydrazinylethyl]pyridin-2-amine.
| Compound Name | 4-[2-(3,5-difluorophenyl)-2-hydrazinylethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105207856 |
| Molecular Formula | C13H14F2N4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 4-[2-(3,5-difluorophenyl)-2-hydrazinylethyl]pyridin-2-amine |
| SMILES | NNC(Cc1ccnc(N)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H14F2N4/c14-10-5-9(6-11(15)7-10)12(19-17)3-8-1-2-18-13(16)4-8/h1-2,4-7,12,19H,3,17H2,(H2,16,18) |
| InChIKey | JVCDYHBGEJIURR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|