C11H14N6 — CID 105203672
4-(2-hydrazinyl-2-pyrimidin-2-ylethyl)pyridin-2-amine (PubChem CID 105203672) has the molecular formula C11H14N6 and a molecular weight of 230.28 g/mol. Its IUPAC name is 4-(2-hydrazinyl-2-pyrimidin-2-ylethyl)pyridin-2-amine.
| Compound Name | 4-(2-hydrazinyl-2-pyrimidin-2-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105203672 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-(2-hydrazinyl-2-pyrimidin-2-ylethyl)pyridin-2-amine |
| SMILES | NNC(Cc1ccnc(N)c1)c1ncccn1 |
| InChI | InChI=1S/C11H14N6/c12-10-7-8(2-5-14-10)6-9(17-13)11-15-3-1-4-16-11/h1-5,7,9,17H,6,13H2,(H2,12,14) |
| InChIKey | SHIASUUQPPXOIR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|