C10H18N4O — CID 105235296
4-(3-ethoxy-2-hydrazinylpropyl)pyridin-2-amine (PubChem CID 105235296) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-(3-ethoxy-2-hydrazinylpropyl)pyridin-2-amine.
| Compound Name | 4-(3-ethoxy-2-hydrazinylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105235296 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 4-(3-ethoxy-2-hydrazinylpropyl)pyridin-2-amine |
| SMILES | CCOCC(Cc1ccnc(N)c1)NN |
| InChI | InChI=1S/C10H18N4O/c1-2-15-7-9(14-12)5-8-3-4-13-10(11)6-8/h3-4,6,9,14H,2,5,7,12H2,1H3,(H2,11,13) |
| InChIKey | SPQJRRSAIIXSPB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|