C14H26N6 — CID 105260183
4-[3-(1,4-dimethylpiperazin-2-yl)-2-hydrazinylpropyl]pyridin-2-amine (PubChem CID 105260183) has the molecular formula C14H26N6 and a molecular weight of 278.40 g/mol. Its IUPAC name is 4-[3-(1,4-dimethylpiperazin-2-yl)-2-hydrazinylpropyl]pyridin-2-amine.
| Compound Name | 4-[3-(1,4-dimethylpiperazin-2-yl)-2-hydrazinylpropyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105260183 |
| Molecular Formula | C14H26N6 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4-[3-(1,4-dimethylpiperazin-2-yl)-2-hydrazinylpropyl]pyridin-2-amine |
| SMILES | CN1CCN(C)C(CC(Cc2ccnc(N)c2)NN)C1 |
| InChI | InChI=1S/C14H26N6/c1-19-5-6-20(2)13(10-19)9-12(18-16)7-11-3-4-17-14(15)8-11/h3-4,8,12-13,18H,5-7,9-10,16H2,1-2H3,(H2,15,17) |
| InChIKey | IJVIMUFUHAZAJI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|