C16H27N3O — CID 115415228
3-[3-(1,4-dimethylpiperazin-2-yl)-2-(methylamino)propyl]phenol (PubChem CID 115415228) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-[3-(1,4-dimethylpiperazin-2-yl)-2-(methylamino)propyl]phenol.
| Compound Name | 3-[3-(1,4-dimethylpiperazin-2-yl)-2-(methylamino)propyl]phenol |
|---|---|
| PubChem CID | 115415228 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 3-[3-(1,4-dimethylpiperazin-2-yl)-2-(methylamino)propyl]phenol |
| SMILES | CNC(Cc1cccc(O)c1)CC1CN(C)CCN1C |
| InChI | InChI=1S/C16H27N3O/c1-17-14(9-13-5-4-6-16(20)10-13)11-15-12-18(2)7-8-19(15)3/h4-6,10,14-15,17,20H,7-9,11-12H2,1-3H3 |
| InChIKey | DVWBFBKODKJOED-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |