C13H25N3 — CID 115415360
1-(1,4-dimethylpiperazin-2-yl)-N-methylhex-4-yn-2-amine (PubChem CID 115415360) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-N-methylhex-4-yn-2-amine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-N-methylhex-4-yn-2-amine |
|---|---|
| PubChem CID | 115415360 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-N-methylhex-4-yn-2-amine |
| SMILES | CC#CCC(CC1CN(C)CCN1C)NC |
| InChI | InChI=1S/C13H25N3/c1-5-6-7-12(14-2)10-13-11-15(3)8-9-16(13)4/h12-14H,7-11H2,1-4H3 |
| InChIKey | XEKAGFRANLACTA-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|