C13H24N2O — CID 104804190
1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ol (PubChem CID 104804190) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ol.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ol |
|---|---|
| PubChem CID | 104804190 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ol |
| SMILES | CC#CCCC(O)CC1CN(C)CCN1C |
| InChI | InChI=1S/C13H24N2O/c1-4-5-6-7-13(16)10-12-11-14(2)8-9-15(12)3/h12-13,16H,6-11H2,1-3H3 |
| InChIKey | UJKRTWTZHOFVEV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|