C15H23IN2O — CID 115414970
1-(1,4-dimethylpiperazin-2-yl)-3-(4-iodophenyl)propan-2-ol (PubChem CID 115414970) has the molecular formula C15H23IN2O and a molecular weight of 374.27 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-3-(4-iodophenyl)propan-2-ol.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-3-(4-iodophenyl)propan-2-ol |
|---|---|
| PubChem CID | 115414970 |
| Molecular Formula | C15H23IN2O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-3-(4-iodophenyl)propan-2-ol |
| SMILES | CN1CCN(C)C(CC(O)Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C15H23IN2O/c1-17-7-8-18(2)14(11-17)10-15(19)9-12-3-5-13(16)6-4-12/h3-6,14-15,19H,7-11H2,1-2H3 |
| InChIKey | QQIDQRTYEBXFPK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|