C9H21N3 — CID 115415048
1-(1,4-dimethylpiperazin-2-yl)propan-2-amine (PubChem CID 115415048) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)propan-2-amine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 115415048 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)propan-2-amine |
| SMILES | CC(N)CC1CN(C)CCN1C |
| InChI | InChI=1S/C9H21N3/c1-8(10)6-9-7-11(2)4-5-12(9)3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | WDWWLBUFPWFIGT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |