C14H31N3 — CID 82923377
1-(1,4-dimethylpiperazin-2-yl)-4-ethylhexan-2-amine (PubChem CID 82923377) has the molecular formula C14H31N3 and a molecular weight of 241.42 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-4-ethylhexan-2-amine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-4-ethylhexan-2-amine |
|---|---|
| PubChem CID | 82923377 |
| Molecular Formula | C14H31N3 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.25 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-4-ethylhexan-2-amine |
| SMILES | CCC(CC)CC(N)CC1CN(C)CCN1C |
| InChI | InChI=1S/C14H31N3/c1-5-12(6-2)9-13(15)10-14-11-16(3)7-8-17(14)4/h12-14H,5-11,15H2,1-4H3 |
| InChIKey | PMIZTTGGBZKLPQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |