C13H26N4 — CID 105260226
1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ylhydrazine (PubChem CID 105260226) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ylhydrazine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 105260226 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)hept-5-yn-2-ylhydrazine |
| SMILES | CC#CCCC(CC1CN(C)CCN1C)NN |
| InChI | InChI=1S/C13H26N4/c1-4-5-6-7-12(15-14)10-13-11-16(2)8-9-17(13)3/h12-13,15H,6-11,14H2,1-3H3 |
| InChIKey | SPZWRTHZLMLWSE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|