C13H26N6 — CID 105260156
[1-(1,4-dimethylpiperazin-2-yl)-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105260156) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is [1-(1,4-dimethylpiperazin-2-yl)-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(1,4-dimethylpiperazin-2-yl)-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105260156 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | [1-(1,4-dimethylpiperazin-2-yl)-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CN1CCN(C)C(CC(Cc2ccn(C)n2)NN)C1 |
| InChI | InChI=1S/C13H26N6/c1-17-6-7-18(2)13(10-17)9-12(15-14)8-11-4-5-19(3)16-11/h4-5,12-13,15H,6-10,14H2,1-3H3 |
| InChIKey | SVVOBKBNURADTL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 62.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|