C11H22N4S — CID 105227116
[1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105227116) has the molecular formula C11H22N4S and a molecular weight of 242.39 g/mol. Its IUPAC name is [1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105227116 |
| Molecular Formula | C11H22N4S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | [1-butan-2-ylsulfanyl-3-(1-methylpyrazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CCC(C)SCC(Cc1ccn(C)n1)NN |
| InChI | InChI=1S/C11H22N4S/c1-4-9(2)16-8-11(13-12)7-10-5-6-15(3)14-10/h5-6,9,11,13H,4,7-8,12H2,1-3H3 |
| InChIKey | FIDILCOHKVOEPF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|