C12H23N3S — CID 82876191
N-methyl-1-(2-methylpropylsulfanyl)-3-(1-methylpyrazol-3-yl)propan-2-amine (PubChem CID 82876191) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is N-methyl-1-(2-methylpropylsulfanyl)-3-(1-methylpyrazol-3-yl)propan-2-amine.
| Compound Name | N-methyl-1-(2-methylpropylsulfanyl)-3-(1-methylpyrazol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 82876191 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-methyl-1-(2-methylpropylsulfanyl)-3-(1-methylpyrazol-3-yl)propan-2-amine |
| SMILES | CNC(CSCC(C)C)Cc1ccn(C)n1 |
| InChI | InChI=1S/C12H23N3S/c1-10(2)8-16-9-12(13-3)7-11-5-6-15(4)14-11/h5-6,10,12-13H,7-9H2,1-4H3 |
| InChIKey | YFKHTEGKGHXNTH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |