C16H31N3S — CID 65135128
N-methyl-1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-amine (PubChem CID 65135128) has the molecular formula C16H31N3S and a molecular weight of 297.51 g/mol. Its IUPAC name is N-methyl-1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-amine.
| Compound Name | N-methyl-1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 65135128 |
| Molecular Formula | C16H31N3S |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | N-methyl-1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-amine |
| SMILES | CCC(CC)n1ccc(CC(CSCC(C)C)NC)n1 |
| InChI | InChI=1S/C16H31N3S/c1-6-16(7-2)19-9-8-14(18-19)10-15(17-5)12-20-11-13(3)4/h8-9,13,15-17H,6-7,10-12H2,1-5H3 |
| InChIKey | ANQXPGNZJBOXMG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |