C15H30N4S — CID 105226952
[1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-yl]hydrazine (PubChem CID 105226952) has the molecular formula C15H30N4S and a molecular weight of 298.50 g/mol. Its IUPAC name is [1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-yl]hydrazine.
| Compound Name | [1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105226952 |
| Molecular Formula | C15H30N4S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | [1-(2-methylpropylsulfanyl)-3-(1-pentan-3-ylpyrazol-3-yl)propan-2-yl]hydrazine |
| SMILES | CCC(CC)n1ccc(CC(CSCC(C)C)NN)n1 |
| InChI | InChI=1S/C15H30N4S/c1-5-15(6-2)19-8-7-13(18-19)9-14(17-16)11-20-10-12(3)4/h7-8,12,14-15,17H,5-6,9-11,16H2,1-4H3 |
| InChIKey | WZGOMIFPGVMEBL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|