C12H23ClN4S — CID 105227300
[1-butan-2-ylsulfanyl-3-(4-chloro-1,3-dimethylpyrazol-5-yl)propan-2-yl]hydrazine (PubChem CID 105227300) has the molecular formula C12H23ClN4S and a molecular weight of 290.86 g/mol. Its IUPAC name is [1-butan-2-ylsulfanyl-3-(4-chloro-1,3-dimethylpyrazol-5-yl)propan-2-yl]hydrazine.
| Compound Name | [1-butan-2-ylsulfanyl-3-(4-chloro-1,3-dimethylpyrazol-5-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105227300 |
| Molecular Formula | C12H23ClN4S |
| Molecular Weight | 290.86 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [1-butan-2-ylsulfanyl-3-(4-chloro-1,3-dimethylpyrazol-5-yl)propan-2-yl]hydrazine |
| SMILES | CCC(C)SCC(Cc1c(Cl)c(C)nn1C)NN |
| InChI | InChI=1S/C12H23ClN4S/c1-5-8(2)18-7-10(15-14)6-11-12(13)9(3)16-17(11)4/h8,10,15H,5-7,14H2,1-4H3 |
| InChIKey | OTNJOUDTHHFCNG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|