C10H17ClN2O — CID 66057532
2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]butan-1-ol (PubChem CID 66057532) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]butan-1-ol.
| Compound Name | 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 66057532 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]butan-1-ol |
| SMILES | CCC(CO)Cc1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C10H17ClN2O/c1-4-8(6-14)5-9-10(11)7(2)12-13(9)3/h8,14H,4-6H2,1-3H3 |
| InChIKey | IUWKKILSWAUJHJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |