C12H20BrClN2 — CID 83141707
5-[2-(bromomethyl)-3,3-dimethylbutyl]-4-chloro-1,3-dimethylpyrazole (PubChem CID 83141707) has the molecular formula C12H20BrClN2 and a molecular weight of 307.66 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3,3-dimethylbutyl]-4-chloro-1,3-dimethylpyrazole.
| Compound Name | 5-[2-(bromomethyl)-3,3-dimethylbutyl]-4-chloro-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 83141707 |
| Molecular Formula | C12H20BrClN2 |
| Molecular Weight | 307.66 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-[2-(bromomethyl)-3,3-dimethylbutyl]-4-chloro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(CC(CBr)C(C)(C)C)c1Cl |
| InChI | InChI=1S/C12H20BrClN2/c1-8-11(14)10(16(5)15-8)6-9(7-13)12(2,3)4/h9H,6-7H2,1-5H3 |
| InChIKey | VRNBGILZOWCSTA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|