C10H16Cl2N2 — CID 66060387
4-chloro-5-(3-chloro-2,2-dimethylpropyl)-1,3-dimethylpyrazole (PubChem CID 66060387) has the molecular formula C10H16Cl2N2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 4-chloro-5-(3-chloro-2,2-dimethylpropyl)-1,3-dimethylpyrazole.
| Compound Name | 4-chloro-5-(3-chloro-2,2-dimethylpropyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 66060387 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 4-chloro-5-(3-chloro-2,2-dimethylpropyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(CC(C)(C)CCl)c1Cl |
| InChI | InChI=1S/C10H16Cl2N2/c1-7-9(12)8(14(4)13-7)5-10(2,3)6-11/h5-6H2,1-4H3 |
| InChIKey | KZTRUXSMSDCHEH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|