About 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine
4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine (PubChem CID 106140381) has the molecular formula C12H21Cl2N3
and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine |
| PubChem CID | 106140381 |
| Molecular Formula | C12H21Cl2N3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine |
| SMILES | Cc1nn(C)c(CNCC(C)(C)CCCl)c1Cl |
| InChI | InChI=1S/C12H21Cl2N3/c1-9-11(14)10(17(4)16-9)7-15-8-12(2,3)5-6-13/h15H,5-8H2,1-4H3 |
| InChIKey | ULZGJYBEUJJDEG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine?
The IUPAC name of 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine (CID 106140381) is 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine.
What is the SMILES notation for 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine?
The canonical SMILES for 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine is Cc1nn(C)c(CNCC(C)(C)CCCl)c1Cl.
What is the InChIKey of 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine?
The InChIKey is ULZGJYBEUJJDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21Cl2N3/c1-9-11(14)10(17(4)16-9)7-15-8-12(2,3)5-6-13/h15H,5-8H2,1-4H3.
What are the key properties of 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine?
4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine has a molecular weight of 278.23 g/mol, XLogP of 3.13, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,2-dimethylbutan-1-amine is sourced from PubChem (CID 106140381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).