C14H25BrClN3 — CID 106141108
N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-chloro-2,2-dimethylpentan-1-amine (PubChem CID 106141108) has the molecular formula C14H25BrClN3 and a molecular weight of 350.73 g/mol. Its IUPAC name is N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-chloro-2,2-dimethylpentan-1-amine.
| Compound Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-chloro-2,2-dimethylpentan-1-amine |
|---|---|
| PubChem CID | 106141108 |
| Molecular Formula | C14H25BrClN3 |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[(4-bromo-3-ethyl-1-methylpyrazol-5-yl)methyl]-5-chloro-2,2-dimethylpentan-1-amine |
| SMILES | CCc1nn(C)c(CNCC(C)(C)CCCCl)c1Br |
| InChI | InChI=1S/C14H25BrClN3/c1-5-11-13(15)12(19(4)18-11)9-17-10-14(2,3)7-6-8-16/h17H,5-10H2,1-4H3 |
| InChIKey | LZMSPFDJXMWGSC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|