About 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol
3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol (PubChem CID 106175751) has the molecular formula C12H22ClN3O
and a molecular weight of 259.78 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol |
| PubChem CID | 106175751 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol |
| SMILES | CCC(C)(CCO)NCc1c(Cl)c(C)nn1C |
| InChI | InChI=1S/C12H22ClN3O/c1-5-12(3,6-7-17)14-8-10-11(13)9(2)15-16(10)4/h14,17H,5-8H2,1-4H3 |
| InChIKey | ONLAYKOPZLORRP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol?
The IUPAC name of 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol (CID 106175751) is 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol.
What is the SMILES notation for 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol?
The canonical SMILES for 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol is CCC(C)(CCO)NCc1c(Cl)c(C)nn1C.
What is the InChIKey of 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol?
The InChIKey is ONLAYKOPZLORRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22ClN3O/c1-5-12(3,6-7-17)14-8-10-11(13)9(2)15-16(10)4/h14,17H,5-8H2,1-4H3.
What are the key properties of 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol?
3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol has a molecular weight of 259.78 g/mol, XLogP of 2.02, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylamino]-3-methylpentan-1-ol is sourced from PubChem (CID 106175751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).