C12H9ClF5N3 — CID 115564330
N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,3,4,5,6-pentafluoroaniline (PubChem CID 115564330) has the molecular formula C12H9ClF5N3 and a molecular weight of 325.67 g/mol. Its IUPAC name is N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 115564330 |
| Molecular Formula | C12H9ClF5N3 |
| Molecular Weight | 325.67 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-[(4-chloro-1,3-dimethylpyrazol-5-yl)methyl]-2,3,4,5,6-pentafluoroaniline |
| SMILES | Cc1nn(C)c(CNc2c(F)c(F)c(F)c(F)c2F)c1Cl |
| InChI | InChI=1S/C12H9ClF5N3/c1-4-6(13)5(21(2)20-4)3-19-12-10(17)8(15)7(14)9(16)11(12)18/h19H,3H2,1-2H3 |
| InChIKey | WKZONJOAFBSEJN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|