C5H6ClFN2 — CID 170913532
4-chloro-5-fluoro-1,3-dimethylpyrazole (PubChem CID 170913532) has the molecular formula C5H6ClFN2 and a molecular weight of 148.57 g/mol. Its IUPAC name is 4-chloro-5-fluoro-1,3-dimethylpyrazole.
| Compound Name | 4-chloro-5-fluoro-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 170913532 |
| Molecular Formula | C5H6ClFN2 |
| Molecular Weight | 148.57 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | 4-chloro-5-fluoro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(F)c1Cl |
| InChI | InChI=1S/C5H6ClFN2/c1-3-4(6)5(7)9(2)8-3/h1-2H3 |
| InChIKey | NADRXWWJFJCTTF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.57 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |