C6H6ClN2O2- — CID 4744006
4-chloro-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 4744006) has the molecular formula C6H6ClN2O2- and a molecular weight of 173.58 g/mol. Its IUPAC name is 4-chloro-1,3-dimethylpyrazole-5-carboxylate.
| Compound Name | 4-chloro-1,3-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 4744006 |
| Molecular Formula | C6H6ClN2O2- |
| Molecular Weight | 173.58 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 4-chloro-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | Cc1nn(C)c(C(=O)[O-])c1Cl |
| InChI | InChI=1S/C6H7ClN2O2/c1-3-4(7)5(6(10)11)9(2)8-3/h1-2H3,(H,10,11)/p-1 |
| InChIKey | BSCNPVBDEITWDU-UHFFFAOYSA-M |
| XLogP | -0.25 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.58 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |