C13H13ClN2O4S — CID 153210032
(4-methylphenyl)sulfonyl 4-chloro-1,3-dimethylpyrazole-5-carboxylate (PubChem CID 153210032) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl 4-chloro-1,3-dimethylpyrazole-5-carboxylate.
| Compound Name | (4-methylphenyl)sulfonyl 4-chloro-1,3-dimethylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 153210032 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (4-methylphenyl)sulfonyl 4-chloro-1,3-dimethylpyrazole-5-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)c2c(Cl)c(C)nn2C)cc1 |
| InChI | InChI=1S/C13H13ClN2O4S/c1-8-4-6-10(7-5-8)21(18,19)20-13(17)12-11(14)9(2)15-16(12)3/h4-7H,1-3H3 |
| InChIKey | WLPLLANPSDVLON-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|