C18H18O10S2 — CID 12943950
bis-(4-methylphenyl)sulfonyl 2,3-dihydroxybutanedioate (PubChem CID 12943950) has the molecular formula C18H18O10S2 and a molecular weight of 458.47 g/mol. Its IUPAC name is bis-(4-methylphenyl)sulfonyl 2,3-dihydroxybutanedioate.
| Compound Name | bis-(4-methylphenyl)sulfonyl 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 12943950 |
| Molecular Formula | C18H18O10S2 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | bis-(4-methylphenyl)sulfonyl 2,3-dihydroxybutanedioate |
| SMILES | Cc1ccc(S(=O)(=O)OC(=O)C(O)C(O)C(=O)OS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H18O10S2/c1-11-3-7-13(8-4-11)29(23,24)27-17(21)15(19)16(20)18(22)28-30(25,26)14-9-5-12(2)6-10-14/h3-10,15-16,19-20H,1-2H3 |
| InChIKey | CESBNYYLLUSMTM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 161.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|