C17H19NO4S — CID 174911787
(4-methylphenyl)sulfonyl (2S)-2-(methylamino)-3-phenylpropanoate (PubChem CID 174911787) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl (2S)-2-(methylamino)-3-phenylpropanoate.
| Compound Name | (4-methylphenyl)sulfonyl (2S)-2-(methylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 174911787 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (4-methylphenyl)sulfonyl (2S)-2-(methylamino)-3-phenylpropanoate |
| SMILES | CN[C@@H](Cc1ccccc1)C(=O)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-13-8-10-15(11-9-13)23(20,21)22-17(19)16(18-2)12-14-6-4-3-5-7-14/h3-11,16,18H,12H2,1-2H3/t16-/m0/s1 |
| InChIKey | VJLWGEDKMGKSDZ-INIZCTEOSA-N |
| XLogP | 2.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|