About 1-trimethylsilylethenyl 4-methylbenzenesulfonate
1-trimethylsilylethenyl 4-methylbenzenesulfonate (PubChem CID 135085885) has the molecular formula C12H18O3SSi
and a molecular weight of 270.43 g/mol. Its IUPAC name is 1-trimethylsilylethenyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 1-trimethylsilylethenyl 4-methylbenzenesulfonate |
| PubChem CID | 135085885 |
| Molecular Formula | C12H18O3SSi |
| Molecular Weight | 270.43 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-trimethylsilylethenyl 4-methylbenzenesulfonate |
| SMILES | C=C(OS(=O)(=O)c1ccc(C)cc1)[Si](C)(C)C |
| InChI | InChI=1S/C12H18O3SSi/c1-10-6-8-12(9-7-10)16(13,14)15-11(2)17(3,4)5/h6-9H,2H2,1,3-5H3 |
| InChIKey | OERQZLJADPADLB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1-trimethylsilylethenyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-trimethylsilylethenyl 4-methylbenzenesulfonate?
The IUPAC name of 1-trimethylsilylethenyl 4-methylbenzenesulfonate (CID 135085885) is 1-trimethylsilylethenyl 4-methylbenzenesulfonate.
What is the SMILES notation for 1-trimethylsilylethenyl 4-methylbenzenesulfonate?
The canonical SMILES for 1-trimethylsilylethenyl 4-methylbenzenesulfonate is C=C(OS(=O)(=O)c1ccc(C)cc1)[Si](C)(C)C.
What is the InChIKey of 1-trimethylsilylethenyl 4-methylbenzenesulfonate?
The InChIKey is OERQZLJADPADLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3SSi/c1-10-6-8-12(9-7-10)16(13,14)15-11(2)17(3,4)5/h6-9H,2H2,1,3-5H3.
What are the key properties of 1-trimethylsilylethenyl 4-methylbenzenesulfonate?
1-trimethylsilylethenyl 4-methylbenzenesulfonate has a molecular weight of 270.43 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-trimethylsilylethenyl 4-methylbenzenesulfonate is sourced from PubChem (CID 135085885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).