About ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate
ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate (PubChem CID 88828643) has the molecular formula C16H26NO4S+
and a molecular weight of 328.45 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate |
| PubChem CID | 88828643 |
| Molecular Formula | C16H26NO4S+ |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OS(=O)(=O)c1ccc(C)cc1.CC[N+](C)(C)C |
| InChI | InChI=1S/C11H12O4S.C5H14N/c1-8(2)11(12)15-16(13,14)10-6-4-9(3)5-7-10;1-5-6(2,3)4/h4-7H,1H2,2-3H3;5H2,1-4H3/q;+1 |
| InChIKey | FEHQAQLSWFRFLK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate?
The IUPAC name of ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate (CID 88828643) is ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate.
What is the SMILES notation for ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate?
The canonical SMILES for ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate is C=C(C)C(=O)OS(=O)(=O)c1ccc(C)cc1.CC[N+](C)(C)C.
What is the InChIKey of ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate?
The InChIKey is FEHQAQLSWFRFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4S.C5H14N/c1-8(2)11(12)15-16(13,14)10-6-4-9(3)5-7-10;1-5-6(2,3)4/h4-7H,1H2,2-3H3;5H2,1-4H3/q;+1.
What are the key properties of ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate?
ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate has a molecular weight of 328.45 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(trimethyl)azanium;(4-methylphenyl)sulfonyl 2-methylprop-2-enoate is sourced from PubChem (CID 88828643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).