About (4-methylphenyl)sulfonyl pentanoate;hydrate
(4-methylphenyl)sulfonyl pentanoate;hydrate (PubChem CID 89388838) has the molecular formula C12H18O5S
and a molecular weight of 274.34 g/mol. Its IUPAC name is (4-methylphenyl)sulfonyl pentanoate;hydrate.
Molecular Properties
| Compound Name | (4-methylphenyl)sulfonyl pentanoate;hydrate |
| PubChem CID | 89388838 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (4-methylphenyl)sulfonyl pentanoate;hydrate |
| SMILES | CCCCC(=O)OS(=O)(=O)c1ccc(C)cc1.O |
| InChI | InChI=1S/C12H16O4S.H2O/c1-3-4-5-12(13)16-17(14,15)11-8-6-10(2)7-9-11;/h6-9H,3-5H2,1-2H3;1H2 |
| InChIKey | VYNBAYOXYCWIMB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)sulfonyl pentanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)sulfonyl pentanoate;hydrate?
The IUPAC name of (4-methylphenyl)sulfonyl pentanoate;hydrate (CID 89388838) is (4-methylphenyl)sulfonyl pentanoate;hydrate.
What is the SMILES notation for (4-methylphenyl)sulfonyl pentanoate;hydrate?
The canonical SMILES for (4-methylphenyl)sulfonyl pentanoate;hydrate is CCCCC(=O)OS(=O)(=O)c1ccc(C)cc1.O.
What is the InChIKey of (4-methylphenyl)sulfonyl pentanoate;hydrate?
The InChIKey is VYNBAYOXYCWIMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S.H2O/c1-3-4-5-12(13)16-17(14,15)11-8-6-10(2)7-9-11;/h6-9H,3-5H2,1-2H3;1H2.
What are the key properties of (4-methylphenyl)sulfonyl pentanoate;hydrate?
(4-methylphenyl)sulfonyl pentanoate;hydrate has a molecular weight of 274.34 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)sulfonyl pentanoate;hydrate is sourced from PubChem (CID 89388838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).