C15H20O6S — CID 174538474
5-(4-methylphenyl)sulfonyloxy-5-oxo-2-propylpentanoic acid (PubChem CID 174538474) has the molecular formula C15H20O6S and a molecular weight of 328.39 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyloxy-5-oxo-2-propylpentanoic acid.
| Compound Name | 5-(4-methylphenyl)sulfonyloxy-5-oxo-2-propylpentanoic acid |
|---|---|
| PubChem CID | 174538474 |
| Molecular Formula | C15H20O6S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyloxy-5-oxo-2-propylpentanoic acid |
| SMILES | CCCC(CCC(=O)OS(=O)(=O)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C15H20O6S/c1-3-4-12(15(17)18)7-10-14(16)21-22(19,20)13-8-5-11(2)6-9-13/h5-6,8-9,12H,3-4,7,10H2,1-2H3,(H,17,18) |
| InChIKey | MTUFHPYDIIEULR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|