C14H17F3O5S — CID 13379934
ethyl 5,5,5-trifluoro-4-(4-methylphenyl)sulfonyloxypentanoate (PubChem CID 13379934) has the molecular formula C14H17F3O5S and a molecular weight of 354.35 g/mol. Its IUPAC name is ethyl 5,5,5-trifluoro-4-(4-methylphenyl)sulfonyloxypentanoate.
| Compound Name | ethyl 5,5,5-trifluoro-4-(4-methylphenyl)sulfonyloxypentanoate |
|---|---|
| PubChem CID | 13379934 |
| Molecular Formula | C14H17F3O5S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | ethyl 5,5,5-trifluoro-4-(4-methylphenyl)sulfonyloxypentanoate |
| SMILES | CCOC(=O)CCC(OS(=O)(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O5S/c1-3-21-13(18)9-8-12(14(15,16)17)22-23(19,20)11-6-4-10(2)5-7-11/h4-7,12H,3,8-9H2,1-2H3 |
| InChIKey | USANMLTUTYOGDY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|