C20H18F3NO5S — CID 594757
[5-(1,3-dioxoisoindol-2-yl)-1,1,1-trifluoropentan-2-yl] 4-methylbenzenesulfonate (PubChem CID 594757) has the molecular formula C20H18F3NO5S and a molecular weight of 441.43 g/mol. Its IUPAC name is [5-(1,3-dioxoisoindol-2-yl)-1,1,1-trifluoropentan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-(1,3-dioxoisoindol-2-yl)-1,1,1-trifluoropentan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 594757 |
| Molecular Formula | C20H18F3NO5S |
| Molecular Weight | 441.43 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | [5-(1,3-dioxoisoindol-2-yl)-1,1,1-trifluoropentan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CCCN2C(=O)c3ccccc3C2=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3NO5S/c1-13-8-10-14(11-9-13)30(27,28)29-17(20(21,22)23)7-4-12-24-18(25)15-5-2-3-6-16(15)19(24)26/h2-3,5-6,8-11,17H,4,7,12H2,1H3 |
| InChIKey | IWLPKRNSHXEWPJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|