C15H19NO4S — CID 163975331
2-(3-tert-butylsulfonylpropyl)isoindole-1,3-dione (PubChem CID 163975331) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-(3-tert-butylsulfonylpropyl)isoindole-1,3-dione.
| Compound Name | 2-(3-tert-butylsulfonylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 163975331 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 2-(3-tert-butylsulfonylpropyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)S(=O)(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H19NO4S/c1-15(2,3)21(19,20)10-6-9-16-13(17)11-7-4-5-8-12(11)14(16)18/h4-5,7-8H,6,9-10H2,1-3H3 |
| InChIKey | STPIBPYTSPTMPH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|