C13H17ClN2O4S2 — CID 145227537
5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride;thiohydroxylamine (PubChem CID 145227537) has the molecular formula C13H17ClN2O4S2 and a molecular weight of 364.88 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride;thiohydroxylamine.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride;thiohydroxylamine |
|---|---|
| PubChem CID | 145227537 |
| Molecular Formula | C13H17ClN2O4S2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)pentane-1-sulfonyl chloride;thiohydroxylamine |
| SMILES | NS.O=C1c2ccccc2C(=O)N1CCCCCS(=O)(=O)Cl |
| InChI | InChI=1S/C13H14ClNO4S.H3NS/c14-20(18,19)9-5-1-4-8-15-12(16)10-6-2-3-7-11(10)13(15)17;1-2/h2-3,6-7H,1,4-5,8-9H2;2H,1H2 |
| InChIKey | ARVNLUWXGFTBAB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|